This compound is an isotope-labeled research reagent, specifically a trideuteriomethylated derivative of a quaternary ammonium compound. It is primarily used in scientific studies to trace metabolic pathways or investigate biological processes due to its stable isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Amino Nevirapine-d3
isotope-labeled research compound
Acetaminophen Dimer-d6
isotope-labeled research compound
(1,2,3,4,5,6,7,8-2H8)-9H-carbazole
isotope-labeled research compound
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioic acid
isotope-labeled research compound
(R)-Propionyl Carnitine-d3 Chloride
deuterated research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
[(2R)-2-acetyloxy-3-carboxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride
JATPLOXBFFRHDN-WVKKGGDISA-N
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)C.[Cl-]
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.