This compound is a deuterated analytical reference standard used in research and manufacturing settings. Its structure includes a phthalate backbone with deuterium labeling on the aromatic ring, facilitating precise quantification in mass spectrometry and chromatography.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1202865-43-7
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
Dihexyl phthalate-3,4,5,6-d4
isotope labeled internal standard
Amyl Phthalate-d4
n.a
Di-n-butyl phthalate-d4
research compound
1-Nitrosotryptophol
nitrosamine reference standard
(S)-2-((tert-butoxycarbonyl)amino)-2-(2-(trifluoromethyl)phenyl)acetic acid
research compound
Tert-butyl 4-iodobenzoate
Research chemical intermediate
3-[(4-Chlorophenyl)methoxy]-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide
Research compound
dinonyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
DROMNWUQASBTFM-BFNLLCNMSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCCCCC)C(=O)OCCCCCCCCC)[2H])[2H]