Tert-butyl 4-iodobenzoate is an organic compound featuring an aromatic ring substituted with an iodine atom and a tert-butyl ester group. It is primarily used as a research chemical intermediate in laboratory synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 120363-13-5
3-[(4-Chlorophenyl)methoxy]-N-[(1S)-1-phenylethyl]thiophene-2-carboxamide
Research compound
2,7-Diazaspiro[4.4]nonan-1-one hydrochloride
research compound
1,7-diazaspiro[4.4]nonan-6-one hydrochloride
research compound
20-Hydroxy-3,6,9,12,15,18-hexaoxaicosanoic acid
PEG-based research compound for bioconjugation
tert-butyl 4-iodobenzoate
QHHNHUWOOFETNQ-UHFFFAOYSA-N
CC(C)(C)OC(=O)C1=CC=C(C=C1)I