Amyl Phthalate-d4 is a deuterium-labeled derivative of dipentyl phthalate, where four hydrogen atoms on the benzene ring are replaced with deuterium. It is primarily used as a research compound or internal standard in analytical chemistry due to its isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Amyl Phthalate-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
Dihexyl phthalate-3,4,5,6-d4
isotope labeled internal standard
Di-n-nonyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
Di-n-butyl phthalate-d4
research compound
2-Methoxy-17beta-estradiol-1,4,16,16,17-d5
research reagent
2-(Trifluoromethyl)oxirane
n.a
2-tert-Butyl-1,4-benzoquinone
n.a
1,3-Diaminoguanidine monohydrochloride
n.a
dipentyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
IPKKHRVROFYTEK-CXRURWBMSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCC)C(=O)OCCCCC)[2H])[2H]
Amyl Phthalate-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.