Dioctyl phthalate-3,4,5,6-d4 is a deuterium-labeled phthalate compound used primarily as a research reference standard. Its significance lies in its application as an internal standard for analytical methods studying phthalate plasticizers.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dioctyl phthalate-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dihexyl phthalate-3,4,5,6-d4
isotope labeled internal standard
Di-n-nonyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
Amyl Phthalate-d4
n.a
Di-n-butyl phthalate-d4
research compound
2-bromo-1-phenylnaphthalene
chemical intermediate for organic synthesis
2-Hydroxyethyl benzoate
industrial intermediate for specialty chemicals
BENZOYL PEROXIDE
Polymerization catalyst and bleaching agent
Dimethyl 1,4-cyclohexanedicarboxylate
plasticizer and polymer intermediate
dioctyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
MQIUGAXCHLFZKX-AMEAAFLOSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCCCC)C(=O)OCCCCCCCC)[2H])[2H]
Dioctyl phthalate-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.