Dihexyl phthalate-3,4,5,6-d4 is a deuterated form of dihexyl phthalate where four hydrogen atoms on the aromatic ring are replaced with deuterium. It is primarily used as an isotope-labeled internal standard in analytical chemistry and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dihexyl phthalate-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Di-n-nonyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
Amyl Phthalate-d4
n.a
Di-n-butyl phthalate-d4
research compound
4,4,5-trideuterio-5-[dideuterio(morpholin-4-yl)methyl]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one
deuterated internal standard for veterinary drug residue analysis
7-Bromo-1-heptanol
research compound
3,3-Diethoxypropyne
Synthetic building block for organic synthesis
2-AMINO-5-METHOXYPYRIDINE
Research reagent
dihexyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
KCXZNSGUUQJJTR-LSQQNFJSSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCC)C(=O)OCCCCCC)[2H])[2H]
Dihexyl phthalate-3,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.