4-Chloro-3-nitrobenzonitrile is a chemical compound used as a research reagent. It features a benzene ring substituted with chloro, nitro, and nitrile groups, which contributes to its reactivity in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 939-80-0
Benzo[ghi]perylene-d12
Deuterated polycyclic aromatic hydrocarbon standard
Fluoranthene-d10, 98 atom % D
deuterated research standard
Phen-2,3,4,5-d4-ol, 6-chloro-
deuterated research compound
Phen-2,3,5-d3-ol, 4,6-dichloro-
deuterated analytical reference standard
4-chloro-3-nitrobenzonitrile
XBLPHYSLHRGMNW-UHFFFAOYSA-N
C1=CC(=C(C=C1C#N)[N+](=O)[O-])Cl