This compound is a deuterated analytical reference standard, specifically a trideuterated form of 2,4-dichlorophenol. It is primarily used in laboratory research as a stable isotope-labeled standard for analytical chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93951-74-7
2,4-Dinitrophenol-d3
Deuterium-labeled analytical reference standard
Phen-2,3,4,5-d4-ol, 6-nitro-
deuterated research standard
Phen-2,3,5,6-d4-ol, 4-nitro-
deuterated research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
2,4-DICHLOROPHENOL
Intermediate for herbicides and biocides
2,4-dichloro-3,5,6-trideuteriophenol
HFZWRUODUSTPEG-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1O)Cl)[2H])Cl)[2H]