Fluoranthene-d10 is a deuterated research standard in which all ten hydrogen atoms of the fluoranthene molecule are replaced with deuterium (98 atom % D). It is primarily used as an isotopic internal standard in analytical chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93951-69-0
Benzo[k]fluoranthene-d12
Deuterated analytical reference standard
Phen-2,3,4,5-d4-ol, 6-chloro-
deuterated research compound
Phen-2,3,5-d3-ol, 4,6-dichloro-
deuterated analytical reference standard
2,4-Dinitrophenol-d3
Deuterium-labeled analytical reference standard
Phen-2,3,4,5-d4-ol, 6-nitro-
deuterated research standard
3-Bromofluoranthene
research chemical
Fluoranthen-3-ylboronic acid
Chemical synthesis reagent
1,2,3,4,5,6,7,8,9,10-decadeuteriofluoranthene
GVEPBJHOBDJJJI-LHNTUAQVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C4=C3C2=C(C(=C4[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]