4-Methyl-3-nitrobenzonitrile is a research compound consisting of a benzene ring substituted with a methyl group, a nitro group, and a nitrile group. Its significance lies in its utility as a building block for chemical synthesis in laboratory and research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 939-79-7
4-Chloro-3-nitrobenzonitrile
research compound
Benzo[ghi]perylene-d12
Deuterated polycyclic aromatic hydrocarbon standard
Fluoranthene-d10, 98 atom % D
deuterated research standard
Phen-2,3,4,5-d4-ol, 6-chloro-
deuterated research compound
4-methyl-3-nitrobenzonitrile
KOFBNBCOGKLUOM-UHFFFAOYSA-N
CC1=C(C=C(C=C1)C#N)[N+](=O)[O-]