Fmoc-cys (acm) is a side-chain protected amino acid derivative used in solid-phase peptide synthesis. The Fmoc group protects the alpha-amino group while the acetamidomethyl (acm) group protects the thiol side chain of cysteine, enabling selective deprotection during peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 86060-81-3
FMOC-CYS(ME)-OH
research reagent
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
(S)-(+)-3-Hydroxytetrahydrofuran
pharmaceutical intermediate
(R)-2-AMINO-3-METHOXYPROPANOIC ACID HYDROCHLORIDE
Pharmaceutical intermediate for peptide synthesis
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
pharmaceutical intermediate
(2R)-3-(acetamidomethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
CSMYOORPUGPKAP-IBGZPJMESA-N
CC(=O)NCSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13