FMOC-CYS(ME)-OH is a research reagent consisting of a cysteine derivative protected with a fluorenylmethoxycarbonyl (Fmoc) group and methylated on the sulfur atom. It is primarily used in peptide synthesis as a building block for introducing S-methyl-L-cysteine residues.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 138021-87-1
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
D-FMOC-methionine
Protected amino acid for peptide synthesis
Fmoc-S-tert-butyl-cys
side chain protected amino acid
Fmoc-cys (acm)
side-chain protected amino acid for peptide synthesis
2-isopropoxy-5-methyl-4-(piperidin-4-yl)aniline dihydrochloride
research compound
Magnesium bromide 2,4-dimethoxybenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
Sulfuric acid-d2
deuterated solvent and reagent
(S)-methyl 3-(pyrrolidin-2-yl)benzoate hydrochloride
research compound
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylsulfanylpropanoic acid
SKNJDZVHMNQAGO-KRWDZBQOSA-N
CSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13