This compound is a protected amino acid derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a methoxy side chain. It is primarily used as an intermediate in the synthesis of peptides and other pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 86123-95-7
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
(S)-2-Hydroxyethyl 2-amino-3-methylbutanoate 4-methylbenzenesulfonate
pharmaceutical intermediate for acyclovir impurities
Dienogest Impurity G
Pharmaceutical intermediate for dienogest
3-Fluoro-5-iodo-4-methylbenzoic acid
Pharmaceutical intermediate
1-(2,2-DIFLUOROBENZO[D][1,3]DIOXOL-5-YL)CYCLOPROPANECARBONITRILE
pharmaceutical intermediate
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
Building block for peptide synthesis
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
RFGMSGRWQUMJIR-ZCFIWIBFSA-N
CC(C)(C)OC(=O)N[C@H](COC)C(=O)O