2,4,6-Trichlorobenzeneboronic acid is a boronic acid compound containing three chlorine substituents on an aromatic ring. It is primarily used as a research reagent in organic synthesis, particularly in cross-coupling reactions and the preparation of other boron-containing molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 73852-18-3
2,6-Diisopropylphenylboronic acid
boronic acid research compound
2-boronothiophene-3-carboxylic Acid
boronic acid research compound
(6-isopropyldibenzo[b,d]furan-4-yl)boronic acid
boronic acid research compound
2-pyrrolidinylphosphonic acid
research compound
2',3',5'-Tri-O-acetyladenosine
Nucleoside research intermediate
(1S)-1-(4-Chlorophenyl)propan-1-ol
research compound for chiral synthesis
4-(Dimethylamino)phenyldiphenylphosphine
Phosphine ligand for cross-coupling reactions
(2,4,6-trichlorophenyl)boronic acid
JWWBOINZBOIAHR-UHFFFAOYSA-N
B(C1=C(C=C(C=C1Cl)Cl)Cl)(O)O
—