2',3',5'-Tri-O-acetyladenosine is a peracetylated derivative of adenosine used as an intermediate in nucleoside research. Its structure features a protected ribose moiety with acetyl groups at the 2', 3', and 5' positions, making it a valuable building block for oligonucleotide synthesis and modification studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 7387-57-7
(1S)-1-(4-Chlorophenyl)propan-1-ol
research compound for chiral synthesis
4-(Dimethylamino)phenyldiphenylphosphine
Phosphine ligand for cross-coupling reactions
2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
research compound
N-(2-amino-2-methylpropyl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxamide
research compound
2,3,5-Tri-O-acetyl alpha-adenosine
Pharmaceutical intermediate for adenosine derivatives
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate
GCVZNVTXNUTBFB-XNIJJKJLSA-N
CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)OC(=O)C)OC(=O)C