2,6-Diisopropylphenylboronic acid is a boronic acid compound used primarily in research. It features a diisopropyl-substituted aromatic ring and a boronic acid functional group, with properties including two hydrogen bond donors and a molecular weight of approximately 206 g/mol.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 363166-79-4
2-boronothiophene-3-carboxylic Acid
boronic acid research compound
2,4,6-Trichlorobenzeneboronic acid
boronic acid research compound
(6-isopropyldibenzo[b,d]furan-4-yl)boronic acid
boronic acid research compound
3,3-difluoropiperidine
research compound
2-Fluoronicotinamide
research compound
1-(Diphenylmethyl)azetidine-3-carboxylic acid
Research compound
Triethylcholine hydroxide
structure-directing agent for synthesis
[2,6-di(propan-2-yl)phenyl]boronic acid
UPXGMXMTUMCLGD-UHFFFAOYSA-N
B(C1=C(C=CC=C1C(C)C)C(C)C)(O)O
—