3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid is a compound used as a biological buffer reagent. It functions as an amine-containing sulfonic acid derivative, commonly employed in laboratory and research settings to maintain pH stability.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 73463-39-5
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
ADA sodium salt
biological buffer reagent
TAPSO sodium salt
biological buffer reagent
MES potassium salt
biological buffer reagent
Rhodium(II) Octanoate Dimer
research compound
1,2,3,4,5,6,7-heptadeuterioindole
Deuterated indole for research use
(S)-butane-1,2-diol
research compound
Cortisol-9,11,12,12-d4
Deuterated internal standard for analysis
3-(cyclohexylamino)-2-hydroxypropane-1-sulfonic acid
INEWUCPYEUEQTN-UHFFFAOYSA-N
C1CCC(CC1)NCC(CS(=O)(=O)O)O