TAPSO sodium salt is a sodium salt of a sulfonic acid buffering agent. It is commonly utilized as a biological buffer reagent in research and laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 105140-25-8
MES potassium salt
biological buffer reagent
DIPSO sodium salt
biological buffer reagent
POPSO
biological buffer reagent
TES sodium salt
biological buffer reagent
5-Chloroindole-2-carboxylic acid
indolyl carboxylic acid reagent
3,5-Difluorophenylacetic acid
research compound
2-Propenoic acid, 2-phosphonoxy-, monocyclohexylammonium salt
Research compound
Guanosine 5'-triphosphate-5'-adenosine
Nucleoside polyphosphate research reagent
sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate
XRADYQRMWVBZEH-UHFFFAOYSA-M
C(C(CS(=O)(=O)[O-])O)NC(CO)(CO)CO.[Na+]