POPSO is a zwitterionic sulfonic acid compound commonly used as a biological buffer reagent in biochemical and molecular biology research. Its structure contains two hydroxyl and two sulfonic acid groups, providing effective buffering capacity in physiological pH ranges.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 68189-43-5
1-Piperazinepropanesulfonic acid, .beta.-hydroxy-4-(2-hydroxyethyl)-
N-(2-hydroxyethyl)piperazine buffer reagent
Mopso
biological buffering agent
TES sodium salt
biological buffer reagent
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
ADA sodium salt
biological buffer reagent
2-BROMO-6-CHLOROTHIENO[2,3-B]PYRIDINE
Research reagent
4,6-dichloro-3-methylpyridazine
research compound
2-hydroxy-3-[4-(2-hydroxy-3-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid
LVQFQZZGTZFUNF-UHFFFAOYSA-N
C1CN(CCN1CC(CS(=O)(=O)O)O)CC(CS(=O)(=O)O)O