4-Morpholinepropanesulfonic acid, sodium salt is a chemical compound used as a biological buffer reagent. It is commonly employed in biochemical and molecular biology research to maintain stable pH conditions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 71119-22-7
MES sodium salt
Buffering agent for biochemical research
MES potassium salt
biological buffer reagent
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
N-Cyclohexyltaurine
biological buffer reagent
ADA sodium salt
biological buffer reagent
TAPSO sodium salt
biological buffer reagent
N-[(2S)-4-amino-1-[[(2S,3R)-1-[[(2S)-4-amino-1-oxo-1-[[(3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-[(1R)-1-hydroxyethyl]-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]octanamide
research compound
Hibiscetin 3,7,4'-trimethyl ether
Research compound
sodium 3-morpholin-4-ylpropane-1-sulfonate
MWEMXEWFLIDTSJ-UHFFFAOYSA-M
C1COCCN1CCCS(=O)(=O)[O-].[Na+]