1,10-Decanedioic-d16 acid is a deuterated analytical reference standard, chemically a hexadecadeuterio-labeled form of decanedioic acid. It is primarily used in research and laboratory settings as a stable isotope-labeled compound for analytical method development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 73351-71-0
Nonanedioic-D14 Acid
deuterated analytical reference standard
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Hexadecanedioic acid-d28
deuterated reference standard
1,8-OCTANEDIOIC-D12 ACID
deuterated analytical reference standard
Tert-Butylamine borane
Borane reducing agent complex
3-Bromobenzothiophene
Research compound for chemical synthesis
Trans-2,3-Dimethoxycinnamic acid
research compound
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecadeuteriodecanedioic acid
CXMXRPHRNRROMY-SADLKCKLSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O