trans-2,3-Dimethoxycinnamic acid is a research compound that features a cinnamic acid backbone with two methoxy substituents on the aromatic ring. It is primarily used as a laboratory reagent in chemical and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 7345-82-6
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
Rhodium(II) Octanoate Dimer
research compound
1,2,3,4,5,6,7-heptadeuterioindole
Deuterated indole for research use
(S)-butane-1,2-diol
research compound
(E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid
QAXPUWGAGVERSJ-VOTSOKGWSA-N
COC1=CC=CC(=C1OC)/C=C/C(=O)O