This compound is a chemical compound used as a pharmaceutical intermediate. It is primarily significant for the synthesis of floxacrine analogues in research and manufacturing settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 69399-79-7
3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
2-Acetyl-6-methylpyridine
pharmaceutical intermediate
4-Amino-2-fluorobenzotrifluoride
Pharmaceutical intermediate
Rel-1,1-Dimethylethyl (4aR,7aS)-hexahydro-6H-1,4-dioxino[2,3-c]pyrrole-6-carboxylate
Pharmaceutical intermediate for API synthesis
Benzenamine, 4-[(4-methyl-1-piperazinyl)methyl]-3-(trifluoromethyl)-
Pharmaceutical intermediate
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for drug synthesis
5-Methyl-3-phenylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
XJCUKCOLGJDGGN-UHFFFAOYSA-N
CC1=C(C(=NO1)C2=C(C=CC=C2Cl)F)C(=O)Cl