This compound is a pharmaceutical intermediate featuring a piperazine ring and a trifluoromethyl-substituted aniline moiety. It is primarily used in the synthesis of other pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 694499-26-8
Ethyl hydrazinoacetate hydrochloride
Pharmaceutical intermediate for drug synthesis
(-)-Isopinocampheylamine
Pharmaceutical intermediate
3'-Chloro-4'-aminoacetophenone
Pharmaceutical intermediate for synthesis
Ethyl 2-(diphenylmethyleneamino)acetate
Pharmaceutical intermediate for glycine derivatives
1-Nitroso-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
nitrosamine impurity standard
4-[(4-methylpiperazin-1-yl)methyl]benzoic Acid Dihydrochloride
pharmaceutical intermediate
4-[(4-methyl-1-piperazinyl)methyl]benzoyl chloride dihydrochloride
pharmaceutical intermediate
4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline
ZMWAZMYBMAAMAW-UHFFFAOYSA-N
CN1CCN(CC1)CC2=C(C=C(C=C2)N)C(F)(F)F