This compound is a pharmaceutical intermediate, specifically an acyl chloride derivative of an isoxazole ring. It is primarily used as a building block in the synthesis of other chemical compounds for research and manufacturing purposes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 4462-55-9
3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for floxacrine analogues
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
Pharmaceutical intermediate for drug synthesis
2-[(2R)-2-Hydroxy-3-[[4-(3-oxo-4-morpholinyl)phenyl]amino]propyl]-1H-isoindole-1,3(2H)-dione
rivaroxaban intermediate
2-[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-1H-isoindole-1,3(2H)-dione
intermediate for rivaroxaban synthesis
(S)-4-(4-(5-(AMINOMETHYL)-2-OXOOXAZOLIDIN-3-YL)PHENYL)MORPHOLIN-3-ONE
Rivaroxaban intermediate
Boronic acid, (6-(benzoylmethylamino)-5-methyl-3-pyridinyl)-
Pharmaceutical intermediate
5-Methyl-3-phenylisoxazole-4-carbonyl chloride
pharmaceutical intermediate
Ethyl 5-(hydroxymethyl)-3-phenylisoxazole-4-carboxylate
research compound
3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
IZQGELJKDARDMZ-UHFFFAOYSA-N
CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)Cl