2,2'-Bipyridine-4,4'-dicarboxylic acid is a bifunctional organic compound featuring two carboxylic acid groups attached to a bipyridine core. It is primarily used as a ligand in coordination chemistry to form metal-organic frameworks and hydrogen-bonded networks, as described in coordination and structural studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 2,2'-Bipyridine-4,4'-dicarboxylic acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
2,9-DIBROMO-1,10-PHENANTHROLINE
research compound for coordination chemistry
Pyridine-3,5-dicarboxylic acid
research compound for coordination chemistry
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
SPDP
heterobifunctional crosslinking reagent
P-Nitrophenyl phosphate di(tris(hydroxymethyl)methylamine) salt
phosphatase substrate
POPSO
biological buffer reagent
2-(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid
FXPLCAKVOYHAJA-UHFFFAOYSA-N
C1=CN=C(C=C1C(=O)O)C2=NC=CC(=C2)C(=O)O
هل تبحث عن شراء 2,2'-Bipyridine-4,4'-dicarboxylic acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.