2,9-Dibromo-1,10-phenanthroline is a brominated heterocyclic compound used as a ligand in coordination chemistry. Its structure features two bromine atoms at the 2 and 9 positions of the phenanthroline core, providing distinct electronic and steric properties for metal complex formation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 2,9-DIBROMO-1,10-PHENANTHROLINE؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Pyridine-3,5-dicarboxylic acid
research compound for coordination chemistry
2,2'-Bipyridine-4,4'-dicarboxylic acid
research compound for coordination chemistry
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
1,2,3-trichlorobenzene-d3
deuterated analytical reference standard
2-Bromopropane-d7
Deuterated research standard
2-Thiopheneacetyl chloride
chemical intermediate for organic synthesis
N-Methyl-L-alanine
research compound
(PHEN)NIBR2
ligand coordinated nickel complex
2,9-dibromo-1,10-phenanthroline
QNLGXYVSHITTGT-UHFFFAOYSA-N
C1=CC2=C(C3=C1C=CC(=N3)Br)N=C(C=C2)Br
—
هل تبحث عن شراء 2,9-DIBROMO-1,10-PHENANTHROLINE؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.