2,6-Dichlorophenylacetic acid is a chlorinated aromatic carboxylic acid used as a research reagent in organic synthesis. Its structure features a dichlorophenyl ring attached to an acetic acid moiety, contributing to its utility as a building block for further chemical transformations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6575-24-2
2-Fluoro-3-(trifluoromethyl)pyridine
research compound
5-Bromo-4-chloro-3-indolyl phosphate p-toluidine salt
Biochemical staining reagent
2,6-Dichlorobenzenesulfonyl chloride
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
2-(2,6-dichlorophenyl)acetic acid
SFAILOOQFZNOAU-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)CC(=O)O)Cl