4-(Trifluoromethoxy)benzyl Chloride is a chemical compound that serves as a research reagent. It is characterized by the presence of a chloromethyl group and a trifluoromethoxy substituent on an aromatic ring, making it useful in laboratory-scale synthesis and exploratory chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 65796-00-1
4-Nitrophenyl trifluoroacetate
Research reagent for peptide synthesis
Glycyl-L-tyrosine
dipeptide research compound
3,4-Difluorophenylacetic acid
research compound
4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
research compound
1-(chloromethyl)-4-(trifluoromethoxy)benzene
LBMKFQMJURUPKC-UHFFFAOYSA-N
C1=CC(=CC=C1CCl)OC(F)(F)F
—