2,6-Dichlorobenzenesulfonyl chloride is a chemical compound used primarily as a reagent in organic synthesis. It features an aromatic ring substituted with chlorine atoms and a sulfonyl chloride group, contributing to its reactivity in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6579-54-0
1-ethynyl-4-(trifluoromethyl)benzene
chemical reagent for organic synthesis
(2,6-dimethoxypyridin-3-yl)boronic Acid
chemical reagent for organic synthesis
3-Fluoropyridine
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
4-Nitrophenyl trifluoroacetate
Research reagent for peptide synthesis
Glycyl-L-tyrosine
dipeptide research compound
3,4-Difluorophenylacetic acid
research compound
2,6-dichlorobenzenesulfonyl chloride
WGGKQIKICKLWGN-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl
—