Tetrafluoro-4-hydroxybenzoic acid is a fluorinated aromatic carboxylic acid used as an intermediate in organic synthesis. Its structure features a fully fluorinated benzene ring with both carboxylic acid and hydroxyl substituents, contributing to its reactivity and polarity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 652-34-6
2,3,5,6-Tetrafluoroterephthalic acid
Industrial chemical intermediate
Pentafluorobenzoic acid
Synthetic polymer MALDI matrix compound
Ethyl 4-hydroxypiperidine-1-carboxylate
pharmaceutical intermediate
4-(Diphenylmethoxy)piperidinium chloride
pharmaceutical intermediate for ebastine synthesis
(R)-Glycidyl Trityl Ether
Pharmaceutical intermediate for glycidyl ethers
2,2-Bis(3,4-dimethylphenyl)hexafluoropropane
Pharmaceutical intermediate
2,3,5,6-tetrafluoro-4-hydroxybenzoic acid
FTLHGQOBAPTEHE-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)O)F)F)C(=O)O