2,3,5,6-Tetrafluoroterephthalic acid is a fluorinated aromatic dicarboxylic acid used as an industrial chemical intermediate. Its structure features a benzene ring substituted with four fluorine atoms and two carboxylic acid groups, making it a building block for specialty polymers and other advanced materials.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 652-36-8
Pentafluorobenzoic acid
Synthetic polymer MALDI matrix compound
Tetrafluoro-4-hydroxybenzoic acid
Organic synthesis intermediate
4-(trans-4-n-Propylcyclohexyl)benzoic acid
Liquid crystal intermediate
2,6-Dimethylhydroquinone
hydroquinone derivative intermediate
4-Nitro-2-(trifluoromethyl)anisole
chemical intermediate for synthesis
1,8-DIMETHYL-9H-CARBAZOLE
Electronic chemical intermediate
2,3,5,6-tetrafluoroterephthalic acid
WFNRNCNCXRGUKN-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)C(=O)O)F)F)C(=O)O