2-Bromo-4,5-difluorobenzoic acid is a halogenated aromatic carboxylic acid commonly used as a chemical synthesis intermediate. It is typically employed in laboratory and research settings for the preparation of more complex organic molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 2-Bromo-4,5-difluorobenzoic acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
4-bromo-2,5-difluorobenzoic acid
research compound
1-(4-(trifluoromethyl)phenyl)propan-2-one
chemical synthesis intermediate
Methyl 2-Chloro-3-methylbenzoate
chemical synthesis intermediate
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-Cyanophenyl isocyanate
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
3,4-Dimethoxyamphetamine, (R)-
research compound
Quinoline-3-carboxylic acid
research compound
2-bromo-4,5-difluorobenzoic acid
DGCBGBZYTNTZJH-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)Br)C(=O)O
—
هل تبحث عن شراء 2-Bromo-4,5-difluorobenzoic acid؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.