2-Bromo-4,5-difluorobenzoic acid is a halogenated aromatic carboxylic acid commonly used as a chemical synthesis intermediate. It is typically employed in laboratory and research settings for the preparation of more complex organic molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 64695-84-7
4-bromo-2,5-difluorobenzoic acid
research compound
1-(4-(trifluoromethyl)phenyl)propan-2-one
chemical synthesis intermediate
Methyl 2-Chloro-3-methylbenzoate
chemical synthesis intermediate
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-Cyanophenyl isocyanate
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
3,4-Dimethoxyamphetamine, (R)-
research compound
Quinoline-3-carboxylic acid
research compound
2-bromo-4,5-difluorobenzoic acid
DGCBGBZYTNTZJH-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)Br)C(=O)O
—