This compound is a chiral research compound featuring an amine group and two ether substituents on an aromatic ring. It is primarily used as a laboratory reagent for chemical and pharmacological studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 64778-78-5
Quinoline-3-carboxylic acid
research compound
Val-Leu-Arg-p-nitroanilide
chromogenic substrate for enzyme assays
Methyl 4-bromo-5-formylthiophene-2-carboxylate
Research compound
Leuphasyl
research compound
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine
research compound for serotonin receptor studies
(2R)-1-(3,4-dimethoxyphenyl)propan-2-amine
KAZPHAGSWZTKDW-MRVPVSSYSA-N
C[C@H](CC1=CC(=C(C=C1)OC)OC)N