Leuphasyl is a peptide-based compound used primarily as a research reagent. It is a pentapeptide derivative with a specific stereochemistry, characterized by multiple amide bonds and a phenolic side chain, and is supplied for laboratory and research purposes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 64963-01-5
L-Aspartic acid, L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucyl-
research compound
Leu-enkephalin
active pharmaceutical ingredient
Orotic acid
Biochemical research for nucleic acid biosynthesis
Magnesium chloride ethyn-1-ide (1/1/1)
Grignard reagent for organic synthesis
[Ru(bpm)3][Cl]2, AldrichCPR
research compound
1,4-Bis(dicyclohexylphosphino)butane
phosphine ligand for catalysis
MET-enkephalin
endogenous opioid peptide
L-Tyrosine, L-lysyl-L-lysyl-L-lysyl-L-leucyl-L-arginyl-L-arginyl-L-glutaminyl-L-|A-glutamyl-L-alanyl-L-phenylalanyl-L-|A-aspartyl-L-alanyl-
peptide research reagent
(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid
ZHUJMSMQIPIPTF-JMBSJVKXSA-N
C[C@H](C(=O)NCC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CC2=CC=C(C=C2)O)N