4-Bromo-2,5-difluorobenzoic acid is a halogenated benzoic acid derivative commonly utilized as a research reagent in chemical and pharmaceutical development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 28314-82-1
2-Bromo-4,5-difluorobenzoic acid
chemical synthesis intermediate
5-Hydroxy-1-tetralone
reagent for glucose determination
2-Bromo-9,9-dimethylfluorene
Organic synthesis reagent
Sulfur trioxide-pyridine
sulfonation and sulfation reagent
S-Trifluoromethyl-2,8-bis(trifluoromethoxy)dibenzothiophenium Triflate
research reagent for organic synthesis
4-bromo-2,5-difluorobenzoic acid
YWZSTHLOAZTDFJ-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)Br)F)C(=O)O
—