Dimethyl L-tartrate is a chiral chemical compound derived from tartaric acid, commonly used as a pharmaceutical intermediate in drug synthesis. Its structure features two ester and two alcohol functional groups, contributing to its role in the production of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 608-68-4
(1S)-1-(3-Ethoxy-4-methoxy-phenyl)-2-methanesulfonyl-ethylamine
Pharmaceutical intermediate for drug synthesis
(S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanamine (S)-2-acetamido-4-methylpentanoate
pharmaceutical intermediate
(S)-(+)-3-Chloro-1,2-propanediol
pharmaceutical intermediate
3-amino-N-(tert-butyl)benzenesulfonamide
pharmaceutical intermediate
Butanedioic acid, 2,3-dihydroxy-, dimethyl ester, (2S,3S)-
chiral pharmaceutical intermediate
dimethyl (2R,3R)-2,3-dihydroxybutanedioate
PVRATXCXJDHJJN-QWWZWVQMSA-N
COC(=O)[C@@H]([C@H](C(=O)OC)O)O