3-Amino-N-(tert-butyl)benzenesulfonamide is a chemical compound used as a pharmaceutical intermediate. Its structure features both an amine group and a sulfonamide group attached to an aromatic ring, making it a building block in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 608523-94-0
4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid
Pharmaceutical intermediate for drug synthesis
DIETHYL METHYLMALONATE
Pharmaceutical intermediate
Ethyl 2-methylacetoacetate
Pharmaceutical intermediate
Ethyl 2-chloroacetoacetate
Pharmaceutical intermediate
3-amino-N-tert-butylbenzenesulfonamide
KLQVFEHOLLUULE-UHFFFAOYSA-N
CC(C)(C)NS(=O)(=O)C1=CC=CC(=C1)N
—