This compound is a chiral compound used as a pharmaceutical intermediate. Its structure features two alcohol and two ester functional groups, contributing to its role in the synthesis of optically active molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13171-64-7
(3S)-4-chloro-3-hydroxybutanenitrile
chiral pharmaceutical intermediate
BENZYL (3-BROMO-2-OXOPROPYL)CARBAMATE
pharmaceutical intermediate
6-(Trifluoromethyl)pyridine-2-carboxylic acid
Pharmaceutical intermediate
(2-fluoropyridin-4-yl)methanol
pharmaceutical intermediate
Ethyl 4-bromo-3-oxobutanoate
Pharmaceutical intermediate
Dimethyl L-tartrate
Pharmaceutical intermediate for drug synthesis
dimethyl (2S,3S)-2,3-dihydroxybutanedioate
PVRATXCXJDHJJN-IMJSIDKUSA-N
COC(=O)[C@H]([C@@H](C(=O)OC)O)O