L-Phenylalanine-2-d1 is a deuterium-labeled derivative of the amino acid L-phenylalanine, where one hydrogen atom at the 2-position is replaced by deuterium. It is primarily used as an isotopically labeled research compound in analytical chemistry and metabolic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء L-Phenylalanine-2-d1؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
4-Aminophenol-d4
isotopically labeled research compound
2,4'-Dibromoacetophenone-2-13C
isotopically labeled research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
5-bromo-4-methylthiophene-2-carboxylic acid
research compound
5-Iodo-2-methylbenzoic acid
Research reagent
3,3',5,5'-TETRAMETHYLBENZIDINE
clinical reagent for testing blood
6-Bromo-1-methoxynaphthalene
research compound
L-Phenyl-d5-alanine
Deuterated research compound
رمز النظام المنسق (HS) الدولي للمادة L-Phenylalanine-2-d1 (CAS 54793-54-3) هو 2845.90.
2845.90
2845 90 10
التصنيف وفق جرد الجمارك الأوروبي ECICS (لقطة 2026-07، النظام المنسق 2022). قد تؤثر البنود التعريفية الوطنية وشكل المنتج على التصنيف النهائي.
(2S)-2-amino-2-deuterio-3-phenylpropanoic acid
COLNVLDHVKWLRT-ZXEPEWCSSA-N
[2H][C@](CC1=CC=CC=C1)(C(=O)O)N
هل تبحث عن شراء L-Phenylalanine-2-d1؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.