This compound is a brominated methoxynaphthalene derivative commonly used as a research reagent in organic synthesis and laboratory studies. Its structure features an aromatic ring system with a bromine atom and a methoxy group, contributing to its moderate lipophilicity and low polarity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 54828-63-6
Diethyl Methyl-d3-malonate
Deuterated malonate ester research reagent
6-Chloro-N,N-dimethylnicotinamide
research compound
DL-2,3-Diaminopropionic acid hydrochloride
Proteomics research reagent
5-bromo-2-methoxypyridine-3-carboxylic acid
heterocyclic organic acid research compound
6-bromo-1-methoxynaphthalene
SKRSSNLRBLWLCE-UHFFFAOYSA-N
COC1=CC=CC2=C1C=CC(=C2)Br