2,4'-Dibromoacetophenone-2-13C is an isotopically labeled research compound containing a carbon-13 atom at the alpha position of the acetyl group. It is structurally characterized by two bromine substituents and a single aromatic ring, with moderate lipophilicity and low polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 335081-05-5
1,3,5-Tribromobenzene-d3
isotopically labeled research compound
Propane-1,1-d2, 1-iodo-
isotopically labeled research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
2'-Deoxyadenosine monohydrate-1 inverted exclamation marka-13C
isotopically labeled research compound
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
(3-Chloroprop-1-yn-1-yl)benzene
research compound
Methyl (methylsulfinyl)methyl sulfide
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
2-bromo-1-(4-bromophenyl)(213C)ethanone
FKJSFKCZZIXQIP-HOSYLAQJSA-N
C1=CC(=CC=C1C(=O)[13CH2]Br)Br
—