This compound is a carbon-13 labeled version of 4,6-dichloro-1,3-dinitrobenzene, used as a stable isotope labeled research compound. It is primarily employed in analytical and environmental studies where isotopic tracking is required.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 335081-12-4
1,2,4-TRIMETHYLBENZENE-D12
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
(3-Chloroprop-1-yn-1-yl)benzene
research compound
Methyl (methylsulfinyl)methyl sulfide
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
Heptafluorobutyric anhydride
derivatising reagent for gas chromatography
1,5-dichloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene
ZPXDNSYFDIHPOJ-IDEBNGHGSA-N
[13CH]1=[13C]([13C](=[13CH][13C](=[13C]1[N+](=O)[O-])Cl)Cl)[N+](=O)[O-]
—