1,2,4-Trimethylbenzene-d12 is a stable isotope labeled research compound where all twelve hydrogen atoms are replaced with deuterium. It is primarily used as a labeled analog in analytical chemistry and metabolic studies to trace the behavior of the parent compound.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 1,2,4-TRIMETHYLBENZENE-D12؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
2,3-Dimethylpyridine-d9
Deuterated research compound
(Rac)-Cotinine-d4
isotopically labeled analytical reference standard
4-Aminobenzoic Acid-d4
labeled reference standard
2,6-DIMETHYLNAPHTHALENE-D12
deuterated research reference standard
1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene
GWHJZXXIDMPWGX-ZPMNDIOMSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]
هل تبحث عن شراء 1,2,4-TRIMETHYLBENZENE-D12؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.