(-)-2-chloromandelic acid is a chiral aromatic hydroxy acid used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. Its structure features an aromatic ring substituted with chlorine and a chiral alcohol-acid moiety, making it valuable for preparing stereochemically defined drug compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 52950-18-2
2-Carboxymethyl-5-Methoxy-Benzoic Acid
pharmaceutical intermediate
Ethyl 4-hydroxyquinoline-3-carboxylate
Pharmaceutical intermediate
ACETYLSALICYLSALICYLIC ACID
Aspirin related impurity standard
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)-
deuterated tert-butanol intermediate
2-Chloromandelic acid
research compound
(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid
RWOLDZZTBNYTMS-SSDOTTSWSA-N
C1=CC=C(C(=C1)[C@H](C(=O)O)O)Cl