This compound is a deuterated form of tert-butanol, where all hydrogen atoms in the methyl groups and the hydroxyl group are replaced with deuterium. It is primarily used as a pharmaceutical intermediate in the synthesis of deuterated active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 53001-22-2
4-Amino-6-chloropyrimidine
Pharmaceutical intermediate
(2,3,4,5-tetrafluorophenyl)methanol
Pharmaceutical intermediate synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
3-(4,5-Dihydro-1H-imidazol-2-yl)aniline monohydrochloride
pharmaceutical intermediate
Tert-Butanol
Solvent, denaturant, and gasoline additive
Zirconium(iv) t-butoxide
precursor for zirconium containing materials
2-Methyl-2-propan-d9-ol
Deuterated chemical intermediate for synthesis
2-Methylpropan-2-(2H)ol
Deuterated research reagent
1,1,1,3,3,3-hexadeuterio-2-deuteriooxy-2-(trideuteriomethyl)propane
DKGAVHZHDRPRBM-SGLLWXCUSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O[2H]