This compound is a deuterium-labeled form of tert-butyl alcohol, where all nine hydrogen atoms in the methyl groups are replaced with deuterium. It is primarily used as a deuterated chemical intermediate in the synthesis of labeled compounds for pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 25725-11-5
Aminoguanidine bicarbonate
Pharmaceutical intermediate and research reagent
5-chloro-3,4-diazatricyclo[9.4.0.0,2,7]pentadeca-1(15),2(7),3,5,11,13-hexaene
pharmaceutical intermediate
3-cyano-4-isopropoxybenzoic acid
Pharmaceutical intermediate
2,6-Dichloropyridine N-oxide
pharmaceutical intermediate
2-Methylpropan-2-(2H)ol
Deuterated research reagent
2-Propan-1,1,1,3,3,3-d6-ol-d, 2-(methyl-d3)-
deuterated tert-butanol intermediate
Tert-Butanol
Solvent, denaturant, and gasoline additive
Zirconium(iv) t-butoxide
precursor for zirconium containing materials
1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol
DKGAVHZHDRPRBM-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O