2-Chloromandelic acid is a research compound containing a carboxylic acid and a hydroxyl group on a chlorinated aromatic ring. It is primarily used as a research reagent in chemical and pharmaceutical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 10421-85-9
[(3S,5R)-5-(2,4-Difluorophenyl)tetrahydro-5-(iodomethyl)-3-furanyl]methyl 2-methylpropanoate
certified reference standard
3,4-Dihydroxybenzophenone
research compound
IRAK inhibitor 6
IRAK inhibitor research compound
O-Benzyl-D-serine
Research compound for peptide synthesis
(-)-2-chloromandelic acid
pharmaceutical intermediate
2-(2-chlorophenyl)-2-hydroxyacetic acid
RWOLDZZTBNYTMS-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(C(=O)O)O)Cl