Cyanidin chloride is a research reagent and an anthocyanidin compound commonly used as an assay reagent in laboratory studies. It is a salt-like, aromatic, heterocyclic compound with multiple hydroxyl groups, typically investigated for its antioxidant and color-related properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 528-58-5
Cyanidin
plant pigment and antioxidant
Adenosine 5'-monophosphoramidate sodium salt
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
1-Methyl-1-propylpyrrolidinium chloride
Ionic liquid research compound
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol chloride
COAWNPJQKJEHPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O.[Cl-]