Cyanidin is an anthocyanidin cation and a naturally occurring plant pigment. It is known for its antioxidant properties and is studied as a metabolite and neuroprotective agent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13306-05-3
Cyanidin chloride
assay reagent
(1S)-1-(2-chlorophenyl)ethane-1,2-diol
research compound
3,4,5-trimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone;(Z)-but-2-enedioic acid
deuterated reference standard
Ethyl 4-(7-(6-cyano-5-(trifluoromethyl)pyridin-3-yl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]octan-5-yl)-2-fluorobenzoate
research compound
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol
VEVZSMAEJFVWIL-UHFFFAOYSA-O
C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O